C15H23N3O2S — CID 107422451
5-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-2,3-dihydro-1H-isoindole (PubChem CID 107422451) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is 5-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-2,3-dihydro-1H-isoindole.
| Compound Name | 5-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-2,3-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 107422451 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 5-(3,4,5-trimethylpiperazin-1-yl)sulfonyl-2,3-dihydro-1H-isoindole |
| SMILES | CC1CN(S(=O)(=O)c2ccc3c(c2)CNC3)CC(C)N1C |
| InChI | InChI=1S/C15H23N3O2S/c1-11-9-18(10-12(2)17(11)3)21(19,20)15-5-4-13-7-16-8-14(13)6-15/h4-6,11-12,16H,7-10H2,1-3H3 |
| InChIKey | IJVNQAYEKZIKLT-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |