C9H11NO2S — CID 122493957
5-methylsulfonyl-2,3-dihydro-1H-isoindole (PubChem CID 122493957) has the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. Its IUPAC name is 5-methylsulfonyl-2,3-dihydro-1H-isoindole.
| Compound Name | 5-methylsulfonyl-2,3-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 122493957 |
| Molecular Formula | C9H11NO2S |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | 5-methylsulfonyl-2,3-dihydro-1H-isoindole |
| SMILES | CS(=O)(=O)c1ccc2c(c1)CNC2 |
| InChI | InChI=1S/C9H11NO2S/c1-13(11,12)9-3-2-7-5-10-6-8(7)4-9/h2-4,10H,5-6H2,1H3 |
| InChIKey | SSQHAKWDOZBZFV-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |