About methyl formate;5-methylsulfonyl-2,3-dihydro-1H-isoindole;hydrochloride
methyl formate;5-methylsulfonyl-2,3-dihydro-1H-isoindole;hydrochloride (PubChem CID 175195394) has the molecular formula C11H16ClNO4S
and a molecular weight of 293.77 g/mol. Its IUPAC name is methyl formate;5-methylsulfonyl-2,3-dihydro-1H-isoindole;hydrochloride.
Molecular Properties
| Compound Name | methyl formate;5-methylsulfonyl-2,3-dihydro-1H-isoindole;hydrochloride |
| PubChem CID | 175195394 |
| Molecular Formula | C11H16ClNO4S |
| Molecular Weight | 293.77 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | methyl formate;5-methylsulfonyl-2,3-dihydro-1H-isoindole;hydrochloride |
| SMILES | COC=O.CS(=O)(=O)c1ccc2c(c1)CNC2.Cl |
| InChI | InChI=1S/C9H11NO2S.C2H4O2.ClH/c1-13(11,12)9-3-2-7-5-10-6-8(7)4-9;1-4-2-3;/h2-4,10H,5-6H2,1H3;2H,1H3;1H |
| InChIKey | HAEMWNZMJCAMNU-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.77 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methyl formate;5-methylsulfonyl-2,3-dihydro-1H-isoindole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl formate;5-methylsulfonyl-2,3-dihydro-1H-isoindole;hydrochloride?
The IUPAC name of methyl formate;5-methylsulfonyl-2,3-dihydro-1H-isoindole;hydrochloride (CID 175195394) is methyl formate;5-methylsulfonyl-2,3-dihydro-1H-isoindole;hydrochloride.
What is the SMILES notation for methyl formate;5-methylsulfonyl-2,3-dihydro-1H-isoindole;hydrochloride?
The canonical SMILES for methyl formate;5-methylsulfonyl-2,3-dihydro-1H-isoindole;hydrochloride is COC=O.CS(=O)(=O)c1ccc2c(c1)CNC2.Cl.
What is the InChIKey of methyl formate;5-methylsulfonyl-2,3-dihydro-1H-isoindole;hydrochloride?
The InChIKey is HAEMWNZMJCAMNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2S.C2H4O2.ClH/c1-13(11,12)9-3-2-7-5-10-6-8(7)4-9;1-4-2-3;/h2-4,10H,5-6H2,1H3;2H,1H3;1H.
What are the key properties of methyl formate;5-methylsulfonyl-2,3-dihydro-1H-isoindole;hydrochloride?
methyl formate;5-methylsulfonyl-2,3-dihydro-1H-isoindole;hydrochloride has a molecular weight of 293.77 g/mol, XLogP of 0.90, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl formate;5-methylsulfonyl-2,3-dihydro-1H-isoindole;hydrochloride is sourced from PubChem (CID 175195394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).