C11H16ClNO4S — CID 175195394
methyl formate;5-methylsulfonyl-2,3-dihydro-1H-isoindole;hydrochloride (PubChem CID 175195394) has the molecular formula C11H16ClNO4S and a molecular weight of 293.77 g/mol. Its IUPAC name is methyl formate;5-methylsulfonyl-2,3-dihydro-1H-isoindole;hydrochloride.
| Compound Name | methyl formate;5-methylsulfonyl-2,3-dihydro-1H-isoindole;hydrochloride |
|---|---|
| PubChem CID | 175195394 |
| Molecular Formula | C11H16ClNO4S |
| Molecular Weight | 293.77 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | methyl formate;5-methylsulfonyl-2,3-dihydro-1H-isoindole;hydrochloride |
| SMILES | COC=O.CS(=O)(=O)c1ccc2c(c1)CNC2.Cl |
| InChI | InChI=1S/C9H11NO2S.C2H4O2.ClH/c1-13(11,12)9-3-2-7-5-10-6-8(7)4-9;1-4-2-3;/h2-4,10H,5-6H2,1H3;2H,1H3;1H |
| InChIKey | HAEMWNZMJCAMNU-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.77 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|