C12H19NO5S2 — CID 88641424
methanesulfonic acid;7-methylsulfonyl-2,3,4,5-tetrahydro-1H-3-benzazepine (PubChem CID 88641424) has the molecular formula C12H19NO5S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is methanesulfonic acid;7-methylsulfonyl-2,3,4,5-tetrahydro-1H-3-benzazepine.
| Compound Name | methanesulfonic acid;7-methylsulfonyl-2,3,4,5-tetrahydro-1H-3-benzazepine |
|---|---|
| PubChem CID | 88641424 |
| Molecular Formula | C12H19NO5S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | methanesulfonic acid;7-methylsulfonyl-2,3,4,5-tetrahydro-1H-3-benzazepine |
| SMILES | CS(=O)(=O)O.CS(=O)(=O)c1ccc2c(c1)CCNCC2 |
| InChI | InChI=1S/C11H15NO2S.CH4O3S/c1-15(13,14)11-3-2-9-4-6-12-7-5-10(9)8-11;1-5(2,3)4/h2-3,8,12H,4-7H2,1H3;1H3,(H,2,3,4) |
| InChIKey | VLPBCXBFXUDGPL-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|