C10H13NO2S — CID 90176022
1-methyl-5-methylsulfonyl-2,3-dihydroindole (PubChem CID 90176022) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is 1-methyl-5-methylsulfonyl-2,3-dihydroindole.
| Compound Name | 1-methyl-5-methylsulfonyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 90176022 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 1-methyl-5-methylsulfonyl-2,3-dihydroindole |
| SMILES | CN1CCc2cc(S(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C10H13NO2S/c1-11-6-5-8-7-9(14(2,12)13)3-4-10(8)11/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | KFKGCEQCOHOAQD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |