C16H16N2O4S — CID 110729382
N-(1-methyl-2,3-dihydroindol-5-yl)-1,3-benzodioxole-5-sulfonamide (PubChem CID 110729382) has the molecular formula C16H16N2O4S and a molecular weight of 332.38 g/mol. Its IUPAC name is N-(1-methyl-2,3-dihydroindol-5-yl)-1,3-benzodioxole-5-sulfonamide.
| Compound Name | N-(1-methyl-2,3-dihydroindol-5-yl)-1,3-benzodioxole-5-sulfonamide |
|---|---|
| PubChem CID | 110729382 |
| Molecular Formula | C16H16N2O4S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | N-(1-methyl-2,3-dihydroindol-5-yl)-1,3-benzodioxole-5-sulfonamide |
| SMILES | CN1CCc2cc(NS(=O)(=O)c3ccc4c(c3)OCO4)ccc21 |
| InChI | InChI=1S/C16H16N2O4S/c1-18-7-6-11-8-12(2-4-14(11)18)17-23(19,20)13-3-5-15-16(9-13)22-10-21-15/h2-5,8-9,17H,6-7,10H2,1H3 |
| InChIKey | CSIUBQCTHJZCTQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|