C18H21N3O4S — CID 112981618
N-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-benzodioxole-5-sulfonamide (PubChem CID 112981618) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-benzodioxole-5-sulfonamide.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-benzodioxole-5-sulfonamide |
|---|---|
| PubChem CID | 112981618 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-benzodioxole-5-sulfonamide |
| SMILES | CN1CCN(c2ccc(NS(=O)(=O)c3ccc4c(c3)OCO4)cc2)CC1 |
| InChI | InChI=1S/C18H21N3O4S/c1-20-8-10-21(11-9-20)15-4-2-14(3-5-15)19-26(22,23)16-6-7-17-18(12-16)25-13-24-17/h2-7,12,19H,8-11,13H2,1H3 |
| InChIKey | BEYPOWHSQVTIMH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|