C17H17ClN2O4S — CID 110361952
N-(2-chloro-5-pyrrolidin-1-ylphenyl)-1,3-benzodioxole-5-sulfonamide (PubChem CID 110361952) has the molecular formula C17H17ClN2O4S and a molecular weight of 380.85 g/mol. Its IUPAC name is N-(2-chloro-5-pyrrolidin-1-ylphenyl)-1,3-benzodioxole-5-sulfonamide.
| Compound Name | N-(2-chloro-5-pyrrolidin-1-ylphenyl)-1,3-benzodioxole-5-sulfonamide |
|---|---|
| PubChem CID | 110361952 |
| Molecular Formula | C17H17ClN2O4S |
| Molecular Weight | 380.85 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | N-(2-chloro-5-pyrrolidin-1-ylphenyl)-1,3-benzodioxole-5-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(N2CCCC2)ccc1Cl)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H17ClN2O4S/c18-14-5-3-12(20-7-1-2-8-20)9-15(14)19-25(21,22)13-4-6-16-17(10-13)24-11-23-16/h3-6,9-10,19H,1-2,7-8,11H2 |
| InChIKey | AQGQTIOWMIEDBE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.85 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |