C11H15ClN2O2S — CID 110361942
N-(2-chloro-5-pyrrolidin-1-ylphenyl)methanesulfonamide (PubChem CID 110361942) has the molecular formula C11H15ClN2O2S and a molecular weight of 274.77 g/mol. Its IUPAC name is N-(2-chloro-5-pyrrolidin-1-ylphenyl)methanesulfonamide.
| Compound Name | N-(2-chloro-5-pyrrolidin-1-ylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 110361942 |
| Molecular Formula | C11H15ClN2O2S |
| Molecular Weight | 274.77 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | N-(2-chloro-5-pyrrolidin-1-ylphenyl)methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc(N2CCCC2)ccc1Cl |
| InChI | InChI=1S/C11H15ClN2O2S/c1-17(15,16)13-11-8-9(4-5-10(11)12)14-6-2-3-7-14/h4-5,8,13H,2-3,6-7H2,1H3 |
| InChIKey | LUPVHKWSNADNBO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.77 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |