C14H19F3N2O2S — CID 13062385
N-[5-(azepan-1-yl)-2-methylphenyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 13062385) has the molecular formula C14H19F3N2O2S and a molecular weight of 336.38 g/mol. Its IUPAC name is N-[5-(azepan-1-yl)-2-methylphenyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[5-(azepan-1-yl)-2-methylphenyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 13062385 |
| Molecular Formula | C14H19F3N2O2S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-[5-(azepan-1-yl)-2-methylphenyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | Cc1ccc(N2CCCCCC2)cc1NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C14H19F3N2O2S/c1-11-6-7-12(19-8-4-2-3-5-9-19)10-13(11)18-22(20,21)14(15,16)17/h6-7,10,18H,2-5,8-9H2,1H3 |
| InChIKey | LXPALMUXAPIHIL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |