C14H17F3N2O4S — CID 18448491
3-[4-methyl-3-(trifluoromethylsulfonylamino)phenyl]piperidine-1-carboxylic acid (PubChem CID 18448491) has the molecular formula C14H17F3N2O4S and a molecular weight of 366.36 g/mol. Its IUPAC name is 3-[4-methyl-3-(trifluoromethylsulfonylamino)phenyl]piperidine-1-carboxylic acid.
| Compound Name | 3-[4-methyl-3-(trifluoromethylsulfonylamino)phenyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 18448491 |
| Molecular Formula | C14H17F3N2O4S |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 3-[4-methyl-3-(trifluoromethylsulfonylamino)phenyl]piperidine-1-carboxylic acid |
| SMILES | Cc1ccc(C2CCCN(C(=O)O)C2)cc1NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C14H17F3N2O4S/c1-9-4-5-10(11-3-2-6-19(8-11)13(20)21)7-12(9)18-24(22,23)14(15,16)17/h4-5,7,11,18H,2-3,6,8H2,1H3,(H,20,21) |
| InChIKey | OILIDGYTALBPOJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |