C13H9BrClNO4S — CID 106610854
N-(1,3-benzodioxol-5-yl)-3-bromo-4-chlorobenzenesulfonamide (PubChem CID 106610854) has the molecular formula C13H9BrClNO4S and a molecular weight of 390.64 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-3-bromo-4-chlorobenzenesulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-3-bromo-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 106610854 |
| Molecular Formula | C13H9BrClNO4S |
| Molecular Weight | 390.64 g/mol |
| Exact Mass | 388.91 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-3-bromo-4-chlorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc2c(c1)OCO2)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C13H9BrClNO4S/c14-10-6-9(2-3-11(10)15)21(17,18)16-8-1-4-12-13(5-8)20-7-19-12/h1-6,16H,7H2 |
| InChIKey | MEFSIWVDUYIBOR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.64 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_C(5)', 'substructure': 'N/A'} |
|---|