C20H24N2O4S — CID 112985026
N-[4-(cycloheptylamino)phenyl]-1,3-benzodioxole-5-sulfonamide (PubChem CID 112985026) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is N-[4-(cycloheptylamino)phenyl]-1,3-benzodioxole-5-sulfonamide.
| Compound Name | N-[4-(cycloheptylamino)phenyl]-1,3-benzodioxole-5-sulfonamide |
|---|---|
| PubChem CID | 112985026 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | N-[4-(cycloheptylamino)phenyl]-1,3-benzodioxole-5-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(NC2CCCCCC2)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H24N2O4S/c23-27(24,18-11-12-19-20(13-18)26-14-25-19)22-17-9-7-16(8-10-17)21-15-5-3-1-2-4-6-15/h7-13,15,21-22H,1-6,14H2 |
| InChIKey | QDEQLZREGQZRLU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |