C18H19NO5S — CID 110426256
N-(1,3-benzodioxol-5-yl)-4-cyclopentyloxybenzenesulfonamide (PubChem CID 110426256) has the molecular formula C18H19NO5S and a molecular weight of 361.42 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-4-cyclopentyloxybenzenesulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-4-cyclopentyloxybenzenesulfonamide |
|---|---|
| PubChem CID | 110426256 |
| Molecular Formula | C18H19NO5S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-4-cyclopentyloxybenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc2c(c1)OCO2)c1ccc(OC2CCCC2)cc1 |
| InChI | InChI=1S/C18H19NO5S/c20-25(21,19-13-5-10-17-18(11-13)23-12-22-17)16-8-6-15(7-9-16)24-14-3-1-2-4-14/h5-11,14,19H,1-4,12H2 |
| InChIKey | UXSXXDWUMQUGPN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_C(5)', 'substructure': 'N/A'} |
|---|