C19H22N2O6S — CID 7413187
(2S)-2-[4-(1,3-benzodioxol-5-ylsulfamoyl)phenoxy]-N-propan-2-ylpropanamide (PubChem CID 7413187) has the molecular formula C19H22N2O6S and a molecular weight of 406.46 g/mol. Its IUPAC name is (2S)-2-[4-(1,3-benzodioxol-5-ylsulfamoyl)phenoxy]-N-propan-2-ylpropanamide.
| Compound Name | (2S)-2-[4-(1,3-benzodioxol-5-ylsulfamoyl)phenoxy]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 7413187 |
| Molecular Formula | C19H22N2O6S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | (2S)-2-[4-(1,3-benzodioxol-5-ylsulfamoyl)phenoxy]-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)[C@H](C)Oc1ccc(S(=O)(=O)Nc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C19H22N2O6S/c1-12(2)20-19(22)13(3)27-15-5-7-16(8-6-15)28(23,24)21-14-4-9-17-18(10-14)26-11-25-17/h4-10,12-13,21H,11H2,1-3H3,(H,20,22)/t13-/m0/s1 |
| InChIKey | TUEYWNKNHRPXFU-ZDUSSCGKSA-N |
| XLogP | 2.51 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_C(5)', 'substructure': 'N/A'} |
|---|