C18H19N3O5 — CID 27519394
1-(1,3-benzodioxol-5-yl)-3-[[(2R)-2-(4-methylphenoxy)propanoyl]amino]urea (PubChem CID 27519394) has the molecular formula C18H19N3O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[[(2R)-2-(4-methylphenoxy)propanoyl]amino]urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[[(2R)-2-(4-methylphenoxy)propanoyl]amino]urea |
|---|---|
| PubChem CID | 27519394 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[[(2R)-2-(4-methylphenoxy)propanoyl]amino]urea |
| SMILES | Cc1ccc(O[C@H](C)C(=O)NNC(=O)Nc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C18H19N3O5/c1-11-3-6-14(7-4-11)26-12(2)17(22)20-21-18(23)19-13-5-8-15-16(9-13)25-10-24-15/h3-9,12H,10H2,1-2H3,(H,20,22)(H2,19,21,23)/t12-/m1/s1 |
| InChIKey | COXDCMAGWHFTFF-GFCCVEGCSA-N |
| XLogP | 2.34 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|