C16H13N3O4S — CID 110731351
N-(4-pyrazol-1-ylphenyl)-1,3-benzodioxole-5-sulfonamide (PubChem CID 110731351) has the molecular formula C16H13N3O4S and a molecular weight of 343.36 g/mol. Its IUPAC name is N-(4-pyrazol-1-ylphenyl)-1,3-benzodioxole-5-sulfonamide.
| Compound Name | N-(4-pyrazol-1-ylphenyl)-1,3-benzodioxole-5-sulfonamide |
|---|---|
| PubChem CID | 110731351 |
| Molecular Formula | C16H13N3O4S |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | N-(4-pyrazol-1-ylphenyl)-1,3-benzodioxole-5-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(-n2cccn2)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H13N3O4S/c20-24(21,14-6-7-15-16(10-14)23-11-22-15)18-12-2-4-13(5-3-12)19-9-1-8-17-19/h1-10,18H,11H2 |
| InChIKey | KLTHWHNYGSVPHC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |