C19H16N2O4S — CID 112989197
N-[4-(1,3-benzodioxol-5-ylamino)phenyl]benzenesulfonamide (PubChem CID 112989197) has the molecular formula C19H16N2O4S and a molecular weight of 368.41 g/mol. Its IUPAC name is N-[4-(1,3-benzodioxol-5-ylamino)phenyl]benzenesulfonamide.
| Compound Name | N-[4-(1,3-benzodioxol-5-ylamino)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 112989197 |
| Molecular Formula | C19H16N2O4S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | N-[4-(1,3-benzodioxol-5-ylamino)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Nc2ccc3c(c2)OCO3)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H16N2O4S/c22-26(23,17-4-2-1-3-5-17)21-15-8-6-14(7-9-15)20-16-10-11-18-19(12-16)25-13-24-18/h1-12,20-21H,13H2 |
| InChIKey | YLEZRFKFCJSLPU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |