C15H13NO4S — CID 24867440
(Z)-N-(1,3-benzodioxol-5-yl)-2-phenylethenesulfonamide (PubChem CID 24867440) has the molecular formula C15H13NO4S and a molecular weight of 303.34 g/mol. Its IUPAC name is (Z)-N-(1,3-benzodioxol-5-yl)-2-phenylethenesulfonamide.
| Compound Name | (Z)-N-(1,3-benzodioxol-5-yl)-2-phenylethenesulfonamide |
|---|---|
| PubChem CID | 24867440 |
| Molecular Formula | C15H13NO4S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | (Z)-N-(1,3-benzodioxol-5-yl)-2-phenylethenesulfonamide |
| SMILES | O=S(=O)(/C=C\c1ccccc1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H13NO4S/c17-21(18,9-8-12-4-2-1-3-5-12)16-13-6-7-14-15(10-13)20-11-19-14/h1-10,16H,11H2/b9-8- |
| InChIKey | VSCDCIHCVPJIKO-HJWRWDBZSA-N |
| XLogP | 2.83 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |