C16H18N2O4S2 — CID 2997932
N,N-dimethyl-4-(2-phenylethenylsulfonylamino)benzenesulfonamide (PubChem CID 2997932) has the molecular formula C16H18N2O4S2 and a molecular weight of 366.46 g/mol. Its IUPAC name is N,N-dimethyl-4-(2-phenylethenylsulfonylamino)benzenesulfonamide.
| Compound Name | N,N-dimethyl-4-(2-phenylethenylsulfonylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 2997932 |
| Molecular Formula | C16H18N2O4S2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | N,N-dimethyl-4-(2-phenylethenylsulfonylamino)benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(NS(=O)(=O)C=Cc2ccccc2)cc1 |
| InChI | InChI=1S/C16H18N2O4S2/c1-18(2)24(21,22)16-10-8-15(9-11-16)17-23(19,20)13-12-14-6-4-3-5-7-14/h3-13,17H,1-2H3 |
| InChIKey | MOVXAFKSRWGBBY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |