About (E)-N-(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-2-phenylethenesulfonamide
(E)-N-(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-2-phenylethenesulfonamide (PubChem CID 17419276) has the molecular formula C17H16ClNO4S
and a molecular weight of 365.84 g/mol. Its IUPAC name is (E)-N-(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-2-phenylethenesulfonamide.
Molecular Properties
| Compound Name | (E)-N-(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-2-phenylethenesulfonamide |
| PubChem CID | 17419276 |
| Molecular Formula | C17H16ClNO4S |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | (E)-N-(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-2-phenylethenesulfonamide |
| SMILES | O=S(=O)(/C=C/c1ccccc1)Nc1cc2c(cc1Cl)OCCCO2 |
| InChI | InChI=1S/C17H16ClNO4S/c18-14-11-16-17(23-9-4-8-22-16)12-15(14)19-24(20,21)10-7-13-5-2-1-3-6-13/h1-3,5-7,10-12,19H,4,8-9H2/b10-7+ |
| InChIKey | VFZMILYFSYUVNY-JXMROGBWSA-N |
| XLogP | 3.91 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (E)-N-(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-2-phenylethenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-2-phenylethenesulfonamide?
The IUPAC name of (E)-N-(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-2-phenylethenesulfonamide (CID 17419276) is (E)-N-(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-2-phenylethenesulfonamide.
What is the SMILES notation for (E)-N-(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-2-phenylethenesulfonamide?
The canonical SMILES for (E)-N-(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-2-phenylethenesulfonamide is O=S(=O)(/C=C/c1ccccc1)Nc1cc2c(cc1Cl)OCCCO2.
What is the InChIKey of (E)-N-(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-2-phenylethenesulfonamide?
The InChIKey is VFZMILYFSYUVNY-JXMROGBWSA-N. The full InChI is InChI=1S/C17H16ClNO4S/c18-14-11-16-17(23-9-4-8-22-16)12-15(14)19-24(20,21)10-7-13-5-2-1-3-6-13/h1-3,5-7,10-12,19H,4,8-9H2/b10-7+.
What are the key properties of (E)-N-(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-2-phenylethenesulfonamide?
(E)-N-(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-2-phenylethenesulfonamide has a molecular weight of 365.84 g/mol, XLogP of 3.91, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-2-phenylethenesulfonamide is sourced from PubChem (CID 17419276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).