C23H19N3O6S — CID 6215450
(E)-N-[4-[(1,3-benzodioxole-5-carbonylamino)carbamoyl]phenyl]-2-phenylethenesulfonamide (PubChem CID 6215450) has the molecular formula C23H19N3O6S and a molecular weight of 465.49 g/mol. Its IUPAC name is (E)-N-[4-[(1,3-benzodioxole-5-carbonylamino)carbamoyl]phenyl]-2-phenylethenesulfonamide.
| Compound Name | (E)-N-[4-[(1,3-benzodioxole-5-carbonylamino)carbamoyl]phenyl]-2-phenylethenesulfonamide |
|---|---|
| PubChem CID | 6215450 |
| Molecular Formula | C23H19N3O6S |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | (E)-N-[4-[(1,3-benzodioxole-5-carbonylamino)carbamoyl]phenyl]-2-phenylethenesulfonamide |
| SMILES | O=C(NNC(=O)c1ccc2c(c1)OCO2)c1ccc(NS(=O)(=O)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C23H19N3O6S/c27-22(24-25-23(28)18-8-11-20-21(14-18)32-15-31-20)17-6-9-19(10-7-17)26-33(29,30)13-12-16-4-2-1-3-5-16/h1-14,26H,15H2,(H,24,27)(H,25,28)/b13-12+ |
| InChIKey | SNDHFNKIJHKTIS-OUKQBFOZSA-N |
| XLogP | 2.90 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|