C22H20N4O3S2 — CID 24644076
1-phenyl-3-[[4-[[(E)-2-phenylethenyl]sulfonylamino]benzoyl]amino]thiourea (PubChem CID 24644076) has the molecular formula C22H20N4O3S2 and a molecular weight of 452.56 g/mol. Its IUPAC name is 1-phenyl-3-[[4-[[(E)-2-phenylethenyl]sulfonylamino]benzoyl]amino]thiourea.
| Compound Name | 1-phenyl-3-[[4-[[(E)-2-phenylethenyl]sulfonylamino]benzoyl]amino]thiourea |
|---|---|
| PubChem CID | 24644076 |
| Molecular Formula | C22H20N4O3S2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 1-phenyl-3-[[4-[[(E)-2-phenylethenyl]sulfonylamino]benzoyl]amino]thiourea |
| SMILES | O=C(NNC(=S)Nc1ccccc1)c1ccc(NS(=O)(=O)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C22H20N4O3S2/c27-21(24-25-22(30)23-19-9-5-2-6-10-19)18-11-13-20(14-12-18)26-31(28,29)16-15-17-7-3-1-4-8-17/h1-16,26H,(H,24,27)(H2,23,25,30)/b16-15+ |
| InChIKey | IFGIDWPLZRDHHQ-FOCLMDBBSA-N |
| XLogP | 3.73 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|