C24H22N2O5S — CID 24640952
ethyl 4-[[4-[[(E)-2-phenylethenyl]sulfonylamino]benzoyl]amino]benzoate (PubChem CID 24640952) has the molecular formula C24H22N2O5S and a molecular weight of 450.52 g/mol. Its IUPAC name is ethyl 4-[[4-[[(E)-2-phenylethenyl]sulfonylamino]benzoyl]amino]benzoate.
| Compound Name | ethyl 4-[[4-[[(E)-2-phenylethenyl]sulfonylamino]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 24640952 |
| Molecular Formula | C24H22N2O5S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | ethyl 4-[[4-[[(E)-2-phenylethenyl]sulfonylamino]benzoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2ccc(NS(=O)(=O)/C=C/c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H22N2O5S/c1-2-31-24(28)20-10-12-21(13-11-20)25-23(27)19-8-14-22(15-9-19)26-32(29,30)17-16-18-6-4-3-5-7-18/h3-17,26H,2H2,1H3,(H,25,27)/b17-16+ |
| InChIKey | AHNDLSXVLKTYGJ-WUKNDPDISA-N |
| XLogP | 4.53 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |