C24H22N2O5S — CID 55348887
methyl 4-[[[4-[[(E)-2-phenylethenyl]sulfonylamino]benzoyl]amino]methyl]benzoate (PubChem CID 55348887) has the molecular formula C24H22N2O5S and a molecular weight of 450.52 g/mol. Its IUPAC name is methyl 4-[[[4-[[(E)-2-phenylethenyl]sulfonylamino]benzoyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[4-[[(E)-2-phenylethenyl]sulfonylamino]benzoyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 55348887 |
| Molecular Formula | C24H22N2O5S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | methyl 4-[[[4-[[(E)-2-phenylethenyl]sulfonylamino]benzoyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)c2ccc(NS(=O)(=O)/C=C/c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H22N2O5S/c1-31-24(28)21-9-7-19(8-10-21)17-25-23(27)20-11-13-22(14-12-20)26-32(29,30)16-15-18-5-3-2-4-6-18/h2-16,26H,17H2,1H3,(H,25,27)/b16-15+ |
| InChIKey | BCIBSNUDNIEQRX-FOCLMDBBSA-N |
| XLogP | 3.82 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |