C23H18F3N3O4S — CID 27813316
N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-4-[[(E)-2-phenylethenyl]sulfonylamino]benzamide (PubChem CID 27813316) has the molecular formula C23H18F3N3O4S and a molecular weight of 489.48 g/mol. Its IUPAC name is N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-4-[[(E)-2-phenylethenyl]sulfonylamino]benzamide.
| Compound Name | N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-4-[[(E)-2-phenylethenyl]sulfonylamino]benzamide |
|---|---|
| PubChem CID | 27813316 |
| Molecular Formula | C23H18F3N3O4S |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-4-[[(E)-2-phenylethenyl]sulfonylamino]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(NS(=O)(=O)/C=C/c2ccccc2)cc1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C23H18F3N3O4S/c24-18-10-11-19(22(26)21(18)25)28-20(30)14-27-23(31)16-6-8-17(9-7-16)29-34(32,33)13-12-15-4-2-1-3-5-15/h1-13,29H,14H2,(H,27,31)(H,28,30)/b13-12+ |
| InChIKey | YXPCNDWNMQWRMV-OUKQBFOZSA-N |
| XLogP | 3.88 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|