C15H10ClF3N2O2 — CID 2113466
3-chloro-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide (PubChem CID 2113466) has the molecular formula C15H10ClF3N2O2 and a molecular weight of 342.70 g/mol. Its IUPAC name is 3-chloro-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide.
| Compound Name | 3-chloro-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 2113466 |
| Molecular Formula | C15H10ClF3N2O2 |
| Molecular Weight | 342.70 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 3-chloro-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1cccc(Cl)c1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H10ClF3N2O2/c16-9-3-1-2-8(6-9)15(23)20-7-12(22)21-11-5-4-10(17)13(18)14(11)19/h1-6H,7H2,(H,20,23)(H,21,22) |
| InChIKey | RDIXQUPKLAIBAS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.70 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|