C16H14ClFN4O2S — CID 9468642
3-chloro-N-[2-[2-[(2-fluorophenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]benzamide (PubChem CID 9468642) has the molecular formula C16H14ClFN4O2S and a molecular weight of 380.83 g/mol. Its IUPAC name is 3-chloro-N-[2-[2-[(2-fluorophenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]benzamide.
| Compound Name | 3-chloro-N-[2-[2-[(2-fluorophenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 9468642 |
| Molecular Formula | C16H14ClFN4O2S |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 3-chloro-N-[2-[2-[(2-fluorophenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1cccc(Cl)c1)NNC(=S)Nc1ccccc1F |
| InChI | InChI=1S/C16H14ClFN4O2S/c17-11-5-3-4-10(8-11)15(24)19-9-14(23)21-22-16(25)20-13-7-2-1-6-12(13)18/h1-8H,9H2,(H,19,24)(H,21,23)(H2,20,22,25) |
| InChIKey | KXAYZYZPKPAWNF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|