C21H16ClFN4O2S — CID 11842641
3-chloro-N-[3-[[(2-fluorophenyl)carbamothioylamino]carbamoyl]phenyl]benzamide (PubChem CID 11842641) has the molecular formula C21H16ClFN4O2S and a molecular weight of 442.90 g/mol. Its IUPAC name is 3-chloro-N-[3-[[(2-fluorophenyl)carbamothioylamino]carbamoyl]phenyl]benzamide.
| Compound Name | 3-chloro-N-[3-[[(2-fluorophenyl)carbamothioylamino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 11842641 |
| Molecular Formula | C21H16ClFN4O2S |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | 3-chloro-N-[3-[[(2-fluorophenyl)carbamothioylamino]carbamoyl]phenyl]benzamide |
| SMILES | O=C(NNC(=S)Nc1ccccc1F)c1cccc(NC(=O)c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C21H16ClFN4O2S/c22-15-7-3-5-13(11-15)19(28)24-16-8-4-6-14(12-16)20(29)26-27-21(30)25-18-10-2-1-9-17(18)23/h1-12H,(H,24,28)(H,26,29)(H2,25,27,30) |
| InChIKey | KDNDMKNMJHAMBS-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|