C14H12ClN3O2S — CID 155517349
1-(3-chlorophenyl)-3-[(2-hydroxybenzoyl)amino]thiourea (PubChem CID 155517349) has the molecular formula C14H12ClN3O2S and a molecular weight of 321.79 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[(2-hydroxybenzoyl)amino]thiourea.
| Compound Name | 1-(3-chlorophenyl)-3-[(2-hydroxybenzoyl)amino]thiourea |
|---|---|
| PubChem CID | 155517349 |
| Molecular Formula | C14H12ClN3O2S |
| Molecular Weight | 321.79 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[(2-hydroxybenzoyl)amino]thiourea |
| SMILES | O=C(NNC(=S)Nc1cccc(Cl)c1)c1ccccc1O |
| InChI | InChI=1S/C14H12ClN3O2S/c15-9-4-3-5-10(8-9)16-14(21)18-17-13(20)11-6-1-2-7-12(11)19/h1-8,19H,(H,17,20)(H2,16,18,21) |
| InChIKey | NJESHMCVGWCFEC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.79 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|