C15H13ClN4O2S — CID 161440441
1-[(2-acetylpyridine-3-carbonyl)amino]-3-(3-chlorophenyl)thiourea (PubChem CID 161440441) has the molecular formula C15H13ClN4O2S and a molecular weight of 348.82 g/mol. Its IUPAC name is 1-[(2-acetylpyridine-3-carbonyl)amino]-3-(3-chlorophenyl)thiourea.
| Compound Name | 1-[(2-acetylpyridine-3-carbonyl)amino]-3-(3-chlorophenyl)thiourea |
|---|---|
| PubChem CID | 161440441 |
| Molecular Formula | C15H13ClN4O2S |
| Molecular Weight | 348.82 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 1-[(2-acetylpyridine-3-carbonyl)amino]-3-(3-chlorophenyl)thiourea |
| SMILES | CC(=O)c1ncccc1C(=O)NNC(=S)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H13ClN4O2S/c1-9(21)13-12(6-3-7-17-13)14(22)19-20-15(23)18-11-5-2-4-10(16)8-11/h2-8H,1H3,(H,19,22)(H2,18,20,23) |
| InChIKey | VZEVJXFDDVKYDE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.82 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|