C14H14ClN5O2S3 — CID 25103982
2-[2-[2-[(3-chlorophenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]sulfanyl-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 25103982) has the molecular formula C14H14ClN5O2S3 and a molecular weight of 415.95 g/mol. Its IUPAC name is 2-[2-[2-[(3-chlorophenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]sulfanyl-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[2-[2-[(3-chlorophenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]sulfanyl-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 25103982 |
| Molecular Formula | C14H14ClN5O2S3 |
| Molecular Weight | 415.95 g/mol |
| Exact Mass | 415.00 |
| IUPAC Name | 2-[2-[2-[(3-chlorophenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]sulfanyl-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CSCC(=O)Nc1nccs1)NNC(=S)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H14ClN5O2S3/c15-9-2-1-3-10(6-9)17-13(23)20-19-12(22)8-24-7-11(21)18-14-16-4-5-25-14/h1-6H,7-8H2,(H,19,22)(H,16,18,21)(H2,17,20,23) |
| InChIKey | XOEHDCHZYWTDRC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 95.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.95 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|