C15H13N3O4S2 — CID 18898789
(E)-4-oxo-4-[3-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanylanilino]but-2-enoic acid (PubChem CID 18898789) has the molecular formula C15H13N3O4S2 and a molecular weight of 363.42 g/mol. Its IUPAC name is (E)-4-oxo-4-[3-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanylanilino]but-2-enoic acid.
| Compound Name | (E)-4-oxo-4-[3-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanylanilino]but-2-enoic acid |
|---|---|
| PubChem CID | 18898789 |
| Molecular Formula | C15H13N3O4S2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | (E)-4-oxo-4-[3-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanylanilino]but-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)Nc1cccc(SCC(=O)Nc2nccs2)c1 |
| InChI | InChI=1S/C15H13N3O4S2/c19-12(4-5-14(21)22)17-10-2-1-3-11(8-10)24-9-13(20)18-15-16-6-7-23-15/h1-8H,9H2,(H,17,19)(H,21,22)(H,16,18,20)/b5-4+ |
| InChIKey | SZJOBBRMYIPRPI-SNAWJCMRSA-N |
| XLogP | 2.45 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|