C19H15N3O4S3 — CID 19713255
(E)-4-oxo-4-[4-[2-oxo-2-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]ethyl]sulfanylanilino]but-2-enoic acid (PubChem CID 19713255) has the molecular formula C19H15N3O4S3 and a molecular weight of 445.55 g/mol. Its IUPAC name is (E)-4-oxo-4-[4-[2-oxo-2-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]ethyl]sulfanylanilino]but-2-enoic acid.
| Compound Name | (E)-4-oxo-4-[4-[2-oxo-2-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]ethyl]sulfanylanilino]but-2-enoic acid |
|---|---|
| PubChem CID | 19713255 |
| Molecular Formula | C19H15N3O4S3 |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | (E)-4-oxo-4-[4-[2-oxo-2-[(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]ethyl]sulfanylanilino]but-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)Nc1ccc(SCC(=O)Nc2nc(-c3cccs3)cs2)cc1 |
| InChI | InChI=1S/C19H15N3O4S3/c23-16(7-8-18(25)26)20-12-3-5-13(6-4-12)28-11-17(24)22-19-21-14(10-29-19)15-2-1-9-27-15/h1-10H,11H2,(H,20,23)(H,25,26)(H,21,22,24)/b8-7+ |
| InChIKey | JNIYGYBPMPKERM-BQYQJAHWSA-N |
| XLogP | 4.18 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|