C21H17N3O4S2 — CID 19713252
(E)-4-oxo-4-[4-[2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl]sulfanylanilino]but-2-enoic acid (PubChem CID 19713252) has the molecular formula C21H17N3O4S2 and a molecular weight of 439.52 g/mol. Its IUPAC name is (E)-4-oxo-4-[4-[2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl]sulfanylanilino]but-2-enoic acid.
| Compound Name | (E)-4-oxo-4-[4-[2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl]sulfanylanilino]but-2-enoic acid |
|---|---|
| PubChem CID | 19713252 |
| Molecular Formula | C21H17N3O4S2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | (E)-4-oxo-4-[4-[2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl]sulfanylanilino]but-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)Nc1ccc(SCC(=O)Nc2nc(-c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C21H17N3O4S2/c25-18(10-11-20(27)28)22-15-6-8-16(9-7-15)29-13-19(26)24-21-23-17(12-30-21)14-4-2-1-3-5-14/h1-12H,13H2,(H,22,25)(H,27,28)(H,23,24,26)/b11-10+ |
| InChIKey | BVBAHMPJGUTADF-ZHACJKMWSA-N |
| XLogP | 4.12 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|