C25H23N3O4S2 — CID 19713144
6-[[4-[2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 19713144) has the molecular formula C25H23N3O4S2 and a molecular weight of 493.61 g/mol. Its IUPAC name is 6-[[4-[2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[[4-[2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 19713144 |
| Molecular Formula | C25H23N3O4S2 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | 6-[[4-[2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(CSc1ccc(NC(=O)C2CC=CCC2C(=O)O)cc1)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C25H23N3O4S2/c29-22(28-25-27-21(14-34-25)16-6-2-1-3-7-16)15-33-18-12-10-17(11-13-18)26-23(30)19-8-4-5-9-20(19)24(31)32/h1-7,10-14,19-20H,8-9,15H2,(H,26,30)(H,31,32)(H,27,28,29) |
| InChIKey | HAXRKEGCLWMYGL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|