C22H20Cl2N2O4S — CID 22785698
6-[[4-[2-(3,5-dichloroanilino)-2-oxoethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 22785698) has the molecular formula C22H20Cl2N2O4S and a molecular weight of 479.39 g/mol. Its IUPAC name is 6-[[4-[2-(3,5-dichloroanilino)-2-oxoethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[[4-[2-(3,5-dichloroanilino)-2-oxoethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 22785698 |
| Molecular Formula | C22H20Cl2N2O4S |
| Molecular Weight | 479.39 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | 6-[[4-[2-(3,5-dichloroanilino)-2-oxoethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(CSc1ccc(NC(=O)C2CC=CCC2C(=O)O)cc1)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C22H20Cl2N2O4S/c23-13-9-14(24)11-16(10-13)25-20(27)12-31-17-7-5-15(6-8-17)26-21(28)18-3-1-2-4-19(18)22(29)30/h1-2,5-11,18-19H,3-4,12H2,(H,25,27)(H,26,28)(H,29,30) |
| InChIKey | GFJLIHOFYOANGK-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.39 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|