C22H20BrNO4S — CID 22784697
6-[[4-[2-(4-bromophenyl)-2-oxoethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 22784697) has the molecular formula C22H20BrNO4S and a molecular weight of 474.38 g/mol. Its IUPAC name is 6-[[4-[2-(4-bromophenyl)-2-oxoethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[[4-[2-(4-bromophenyl)-2-oxoethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 22784697 |
| Molecular Formula | C22H20BrNO4S |
| Molecular Weight | 474.38 g/mol |
| Exact Mass | 473.03 |
| IUPAC Name | 6-[[4-[2-(4-bromophenyl)-2-oxoethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(CSc1ccc(NC(=O)C2CC=CCC2C(=O)O)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H20BrNO4S/c23-15-7-5-14(6-8-15)20(25)13-29-17-11-9-16(10-12-17)24-21(26)18-3-1-2-4-19(18)22(27)28/h1-2,5-12,18-19H,3-4,13H2,(H,24,26)(H,27,28) |
| InChIKey | DBZZXFGTKFHYEK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.38 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|