C15H15NO5 — CID 2883124
4-[(6-carboxycyclohex-3-ene-1-carbonyl)amino]benzoic acid (PubChem CID 2883124) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is 4-[(6-carboxycyclohex-3-ene-1-carbonyl)amino]benzoic acid.
| Compound Name | 4-[(6-carboxycyclohex-3-ene-1-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 2883124 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 4-[(6-carboxycyclohex-3-ene-1-carbonyl)amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)C2CC=CCC2C(=O)O)cc1 |
| InChI | InChI=1S/C15H15NO5/c17-13(11-3-1-2-4-12(11)15(20)21)16-10-7-5-9(6-8-10)14(18)19/h1-2,5-8,11-12H,3-4H2,(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | UCJZOPGTBSDHOE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|