C22H22N2O4 — CID 18873838
4-[[6-[(3-methylphenyl)carbamoyl]cyclohex-3-ene-1-carbonyl]amino]benzoic acid (PubChem CID 18873838) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is 4-[[6-[(3-methylphenyl)carbamoyl]cyclohex-3-ene-1-carbonyl]amino]benzoic acid.
| Compound Name | 4-[[6-[(3-methylphenyl)carbamoyl]cyclohex-3-ene-1-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 18873838 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 4-[[6-[(3-methylphenyl)carbamoyl]cyclohex-3-ene-1-carbonyl]amino]benzoic acid |
| SMILES | Cc1cccc(NC(=O)C2CC=CCC2C(=O)Nc2ccc(C(=O)O)cc2)c1 |
| InChI | InChI=1S/C22H22N2O4/c1-14-5-4-6-17(13-14)24-21(26)19-8-3-2-7-18(19)20(25)23-16-11-9-15(10-12-16)22(27)28/h2-6,9-13,18-19H,7-8H2,1H3,(H,23,25)(H,24,26)(H,27,28) |
| InChIKey | PUEYFXOKEBBITQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|