C23H23NO5S — CID 22784698
6-[[4-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 22784698) has the molecular formula C23H23NO5S and a molecular weight of 425.51 g/mol. Its IUPAC name is 6-[[4-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[[4-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 22784698 |
| Molecular Formula | C23H23NO5S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 6-[[4-[2-(4-methoxyphenyl)-2-oxoethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | COc1ccc(C(=O)CSc2ccc(NC(=O)C3CC=CCC3C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C23H23NO5S/c1-29-17-10-6-15(7-11-17)21(25)14-30-18-12-8-16(9-13-18)24-22(26)19-4-2-3-5-20(19)23(27)28/h2-3,6-13,19-20H,4-5,14H2,1H3,(H,24,26)(H,27,28) |
| InChIKey | OJAUTVKHVQLRJX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|