C22H21FN2O4S — CID 18896235
6-[[3-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 18896235) has the molecular formula C22H21FN2O4S and a molecular weight of 428.49 g/mol. Its IUPAC name is 6-[[3-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[[3-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 18896235 |
| Molecular Formula | C22H21FN2O4S |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 6-[[3-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(CSc1cccc(NC(=O)C2CC=CCC2C(=O)O)c1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C22H21FN2O4S/c23-14-8-10-15(11-9-14)24-20(26)13-30-17-5-3-4-16(12-17)25-21(27)18-6-1-2-7-19(18)22(28)29/h1-5,8-12,18-19H,6-7,13H2,(H,24,26)(H,25,27)(H,28,29) |
| InChIKey | UEIMZZRYUGXCKW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|