C21H16N4O6S2 — CID 19713253
(E)-4-[4-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanylanilino]-4-oxobut-2-enoic acid (PubChem CID 19713253) has the molecular formula C21H16N4O6S2 and a molecular weight of 484.52 g/mol. Its IUPAC name is (E)-4-[4-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanylanilino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[4-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanylanilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 19713253 |
| Molecular Formula | C21H16N4O6S2 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | (E)-4-[4-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanylanilino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)Nc1ccc(SCC(=O)Nc2nc(-c3cccc([N+](=O)[O-])c3)cs2)cc1 |
| InChI | InChI=1S/C21H16N4O6S2/c26-18(8-9-20(28)29)22-14-4-6-16(7-5-14)32-12-19(27)24-21-23-17(11-33-21)13-2-1-3-15(10-13)25(30)31/h1-11H,12H2,(H,22,26)(H,28,29)(H,23,24,27)/b9-8+ |
| InChIKey | YOEXVLBCZIJLFE-CMDGGOBGSA-N |
| XLogP | 4.03 |
| TPSA | 151.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|