C21H15Cl2N3O4S2 — CID 19713248
(E)-4-[4-[2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanylanilino]-4-oxobut-2-enoic acid (PubChem CID 19713248) has the molecular formula C21H15Cl2N3O4S2 and a molecular weight of 508.41 g/mol. Its IUPAC name is (E)-4-[4-[2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanylanilino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[4-[2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanylanilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 19713248 |
| Molecular Formula | C21H15Cl2N3O4S2 |
| Molecular Weight | 508.41 g/mol |
| Exact Mass | 506.99 |
| IUPAC Name | (E)-4-[4-[2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanylanilino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)Nc1ccc(SCC(=O)Nc2nc(-c3ccc(Cl)c(Cl)c3)cs2)cc1 |
| InChI | InChI=1S/C21H15Cl2N3O4S2/c22-15-6-1-12(9-16(15)23)17-10-32-21(25-17)26-19(28)11-31-14-4-2-13(3-5-14)24-18(27)7-8-20(29)30/h1-10H,11H2,(H,24,27)(H,29,30)(H,25,26,28)/b8-7+ |
| InChIKey | WHIUKABNAGMRKR-BQYQJAHWSA-N |
| XLogP | 5.43 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.41 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|