C24H18Cl2N4OS3 — CID 19315985
N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide (PubChem CID 19315985) has the molecular formula C24H18Cl2N4OS3 and a molecular weight of 545.54 g/mol. Its IUPAC name is N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide.
| Compound Name | N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 19315985 |
| Molecular Formula | C24H18Cl2N4OS3 |
| Molecular Weight | 545.54 g/mol |
| Exact Mass | 544.00 |
| IUPAC Name | N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide |
| SMILES | O=C(CSc1cccc(NC(=S)Nc2ccccc2)c1)Nc1nc(-c2ccc(Cl)c(Cl)c2)cs1 |
| InChI | InChI=1S/C24H18Cl2N4OS3/c25-19-10-9-15(11-20(19)26)21-13-34-24(29-21)30-22(31)14-33-18-8-4-7-17(12-18)28-23(32)27-16-5-2-1-3-6-16/h1-13H,14H2,(H2,27,28,32)(H,29,30,31) |
| InChIKey | ZIPHVACJQNCPAG-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.54 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|