C26H20Cl2N4O2S3 — CID 19316201
2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 19316201) has the molecular formula C26H20Cl2N4O2S3 and a molecular weight of 587.58 g/mol. Its IUPAC name is 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 19316201 |
| Molecular Formula | C26H20Cl2N4O2S3 |
| Molecular Weight | 587.58 g/mol |
| Exact Mass | 586.01 |
| IUPAC Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)c1ccc(NC(=S)Nc2cccc(SCC(=O)Nc3nc(-c4ccc(Cl)c(Cl)c4)cs3)c2)cc1 |
| InChI | InChI=1S/C26H20Cl2N4O2S3/c1-15(33)16-5-8-18(9-6-16)29-25(35)30-19-3-2-4-20(12-19)36-14-24(34)32-26-31-23(13-37-26)17-7-10-21(27)22(28)11-17/h2-13H,14H2,1H3,(H2,29,30,35)(H,31,32,34) |
| InChIKey | MNQZWKQOQVIFFR-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.58 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|