C19H17N3O2S2 — CID 18899012
2-(3-acetamidophenyl)sulfanyl-N-(4-phenyl-1,3-thiazol-2-yl)acetamide (PubChem CID 18899012) has the molecular formula C19H17N3O2S2 and a molecular weight of 383.50 g/mol. Its IUPAC name is 2-(3-acetamidophenyl)sulfanyl-N-(4-phenyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(3-acetamidophenyl)sulfanyl-N-(4-phenyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 18899012 |
| Molecular Formula | C19H17N3O2S2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 2-(3-acetamidophenyl)sulfanyl-N-(4-phenyl-1,3-thiazol-2-yl)acetamide |
| SMILES | CC(=O)Nc1cccc(SCC(=O)Nc2nc(-c3ccccc3)cs2)c1 |
| InChI | InChI=1S/C19H17N3O2S2/c1-13(23)20-15-8-5-9-16(10-15)25-12-18(24)22-19-21-17(11-26-19)14-6-3-2-4-7-14/h2-11H,12H2,1H3,(H,20,23)(H,21,22,24) |
| InChIKey | COHCFYNUIZWKEJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |