C24H19ClN4OS3 — CID 19315983
N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide (PubChem CID 19315983) has the molecular formula C24H19ClN4OS3 and a molecular weight of 511.10 g/mol. Its IUPAC name is N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide.
| Compound Name | N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 19315983 |
| Molecular Formula | C24H19ClN4OS3 |
| Molecular Weight | 511.10 g/mol |
| Exact Mass | 510.04 |
| IUPAC Name | N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide |
| SMILES | O=C(CSc1cccc(NC(=S)Nc2ccccc2)c1)Nc1nc(-c2ccccc2Cl)cs1 |
| InChI | InChI=1S/C24H19ClN4OS3/c25-20-12-5-4-11-19(20)21-14-33-24(28-21)29-22(30)15-32-18-10-6-9-17(13-18)27-23(31)26-16-7-2-1-3-8-16/h1-14H,15H2,(H2,26,27,31)(H,28,29,30) |
| InChIKey | OXRCNBCTSSZLGC-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.10 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|