C25H24N4O3S2 — CID 19317247
N-(4-acetamidophenyl)-2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanylacetamide (PubChem CID 19317247) has the molecular formula C25H24N4O3S2 and a molecular weight of 492.63 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanylacetamide.
| Compound Name | N-(4-acetamidophenyl)-2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 19317247 |
| Molecular Formula | C25H24N4O3S2 |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | N-(4-acetamidophenyl)-2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanylacetamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)CSc2cccc(NC(=S)Nc3ccc(C(C)=O)cc3)c2)cc1 |
| InChI | InChI=1S/C25H24N4O3S2/c1-16(30)18-6-8-21(9-7-18)28-25(33)29-22-4-3-5-23(14-22)34-15-24(32)27-20-12-10-19(11-13-20)26-17(2)31/h3-14H,15H2,1-2H3,(H,26,31)(H,27,32)(H2,28,29,33) |
| InChIKey | YEGMFSGCNHAEGF-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|