C25H25N3O2S2 — CID 19317209
2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(3,5-dimethylphenyl)acetamide (PubChem CID 19317209) has the molecular formula C25H25N3O2S2 and a molecular weight of 463.63 g/mol. Its IUPAC name is 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(3,5-dimethylphenyl)acetamide.
| Compound Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(3,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 19317209 |
| Molecular Formula | C25H25N3O2S2 |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(3,5-dimethylphenyl)acetamide |
| SMILES | CC(=O)c1ccc(NC(=S)Nc2cccc(SCC(=O)Nc3cc(C)cc(C)c3)c2)cc1 |
| InChI | InChI=1S/C25H25N3O2S2/c1-16-11-17(2)13-22(12-16)26-24(30)15-32-23-6-4-5-21(14-23)28-25(31)27-20-9-7-19(8-10-20)18(3)29/h4-14H,15H2,1-3H3,(H,26,30)(H2,27,28,31) |
| InChIKey | GIRGXFKADREXDJ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|